C30H23N7 — CID 136756427
(2,6-diphenyl-3-phenyldiazenyl-5H-imidazo[1,2-b]pyrazol-7-yl)-(4-methylphenyl)diazene (PubChem CID 136756427) has the molecular formula C30H23N7 and a molecular weight of 481.56 g/mol. Its IUPAC name is (2,6-diphenyl-3-phenyldiazenyl-5H-imidazo[1,2-b]pyrazol-7-yl)-(4-methylphenyl)diazene.
| Compound Name | (2,6-diphenyl-3-phenyldiazenyl-5H-imidazo[1,2-b]pyrazol-7-yl)-(4-methylphenyl)diazene |
|---|---|
| PubChem CID | 136756427 |
| Molecular Formula | C30H23N7 |
| Molecular Weight | 481.56 g/mol |
| Exact Mass | 481.20 |
| IUPAC Name | (2,6-diphenyl-3-phenyldiazenyl-5H-imidazo[1,2-b]pyrazol-7-yl)-(4-methylphenyl)diazene |
| SMILES | Cc1ccc(/N=N/c2c(-c3ccccc3)[nH]n3c(/N=N/c4ccccc4)c(-c4ccccc4)nc23)cc1 |
| InChI | InChI=1S/C30H23N7/c1-21-17-19-25(20-18-21)32-34-28-26(22-11-5-2-6-12-22)36-37-29(28)31-27(23-13-7-3-8-14-23)30(37)35-33-24-15-9-4-10-16-24/h2-20,36H,1H3/b34-32+,35-33+ |
| InChIKey | DTAWJTLXFOEEJC-XUXOKTBYSA-N |
| XLogP | 9.14 |
| TPSA | 82.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.56 |
| LogP ≤ 5 | 9.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|