C24H19N3O2S — CID 13171449
2-[[4-[(4-methylphenyl)diazenyl]-3-phenyl-1,2-oxazol-5-yl]sulfanyl]-1-phenylethanone (PubChem CID 13171449) has the molecular formula C24H19N3O2S and a molecular weight of 413.50 g/mol. Its IUPAC name is 2-[[4-[(4-methylphenyl)diazenyl]-3-phenyl-1,2-oxazol-5-yl]sulfanyl]-1-phenylethanone.
| Compound Name | 2-[[4-[(4-methylphenyl)diazenyl]-3-phenyl-1,2-oxazol-5-yl]sulfanyl]-1-phenylethanone |
|---|---|
| PubChem CID | 13171449 |
| Molecular Formula | C24H19N3O2S |
| Molecular Weight | 413.50 g/mol |
| Exact Mass | 413.12 |
| IUPAC Name | 2-[[4-[(4-methylphenyl)diazenyl]-3-phenyl-1,2-oxazol-5-yl]sulfanyl]-1-phenylethanone |
| SMILES | Cc1ccc(/N=N/c2c(-c3ccccc3)noc2SCC(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C24H19N3O2S/c1-17-12-14-20(15-13-17)25-26-23-22(19-10-6-3-7-11-19)27-29-24(23)30-16-21(28)18-8-4-2-5-9-18/h2-15H,16H2,1H3/b26-25+ |
| InChIKey | ZILIJIBKCHDQSB-OCEACIFDSA-N |
| XLogP | 7.04 |
| TPSA | 67.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.50 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|