C23H20N4OS — CID 170908770
4,6-dimethyl-5-[(4-methylphenyl)diazenyl]-2-phenacylsulfanylpyridine-3-carbonitrile (PubChem CID 170908770) has the molecular formula C23H20N4OS and a molecular weight of 400.51 g/mol. Its IUPAC name is 4,6-dimethyl-5-[(4-methylphenyl)diazenyl]-2-phenacylsulfanylpyridine-3-carbonitrile.
| Compound Name | 4,6-dimethyl-5-[(4-methylphenyl)diazenyl]-2-phenacylsulfanylpyridine-3-carbonitrile |
|---|---|
| PubChem CID | 170908770 |
| Molecular Formula | C23H20N4OS |
| Molecular Weight | 400.51 g/mol |
| Exact Mass | 400.14 |
| IUPAC Name | 4,6-dimethyl-5-[(4-methylphenyl)diazenyl]-2-phenacylsulfanylpyridine-3-carbonitrile |
| SMILES | Cc1ccc(/N=N/c2c(C)nc(SCC(=O)c3ccccc3)c(C#N)c2C)cc1 |
| InChI | InChI=1S/C23H20N4OS/c1-15-9-11-19(12-10-15)26-27-22-16(2)20(13-24)23(25-17(22)3)29-14-21(28)18-7-5-4-6-8-18/h4-12H,14H2,1-3H3/b27-26+ |
| InChIKey | ONIILFUCQRXALK-CYYJNZCTSA-N |
| XLogP | 6.27 |
| TPSA | 78.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.51 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|