C16H12ClN5O3S — CID 102479730
S-[3-cyano-4,6-dimethyl-5-[(4-nitrophenyl)diazenyl]-2-pyridinyl] 2-chloroethanethioate (PubChem CID 102479730) has the molecular formula C16H12ClN5O3S and a molecular weight of 389.82 g/mol. Its IUPAC name is S-[3-cyano-4,6-dimethyl-5-[(4-nitrophenyl)diazenyl]-2-pyridinyl] 2-chloroethanethioate.
| Compound Name | S-[3-cyano-4,6-dimethyl-5-[(4-nitrophenyl)diazenyl]-2-pyridinyl] 2-chloroethanethioate |
|---|---|
| PubChem CID | 102479730 |
| Molecular Formula | C16H12ClN5O3S |
| Molecular Weight | 389.82 g/mol |
| Exact Mass | 389.03 |
| IUPAC Name | S-[3-cyano-4,6-dimethyl-5-[(4-nitrophenyl)diazenyl]-2-pyridinyl] 2-chloroethanethioate |
| SMILES | Cc1nc(SC(=O)CCl)c(C#N)c(C)c1/N=N/c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C16H12ClN5O3S/c1-9-13(8-18)16(26-14(23)7-17)19-10(2)15(9)21-20-11-3-5-12(6-4-11)22(24)25/h3-6H,7H2,1-2H3/b21-20+ |
| InChIKey | XDKPVDUPLOHIRH-QZQOTICOSA-N |
| XLogP | 4.75 |
| TPSA | 121.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.82 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|