About S-[3-cyano-4,6-dimethyl-5-[(4-nitrophenyl)diazenyl]-2-pyridinyl] 2-chloroethanethioate
S-[3-cyano-4,6-dimethyl-5-[(4-nitrophenyl)diazenyl]-2-pyridinyl] 2-chloroethanethioate (PubChem CID 102479730) has the molecular formula C16H12ClN5O3S
and a molecular weight of 389.82 g/mol. Its IUPAC name is S-[3-cyano-4,6-dimethyl-5-[(4-nitrophenyl)diazenyl]-2-pyridinyl] 2-chloroethanethioate.
Molecular Properties
| Compound Name | S-[3-cyano-4,6-dimethyl-5-[(4-nitrophenyl)diazenyl]-2-pyridinyl] 2-chloroethanethioate |
| PubChem CID | 102479730 |
| Molecular Formula | C16H12ClN5O3S |
| Molecular Weight | 389.82 g/mol |
| Exact Mass | 389.03 |
| IUPAC Name | S-[3-cyano-4,6-dimethyl-5-[(4-nitrophenyl)diazenyl]-2-pyridinyl] 2-chloroethanethioate |
| SMILES | Cc1nc(SC(=O)CCl)c(C#N)c(C)c1/N=N/c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C16H12ClN5O3S/c1-9-13(8-18)16(26-14(23)7-17)19-10(2)15(9)21-20-11-3-5-12(6-4-11)22(24)25/h3-6H,7H2,1-2H3/b21-20+ |
| InChIKey | XDKPVDUPLOHIRH-QZQOTICOSA-N |
| XLogP | 4.75 |
| TPSA | 121.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 389.82 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze S-[3-cyano-4,6-dimethyl-5-[(4-nitrophenyl)diazenyl]-2-pyridinyl] 2-chloroethanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-[3-cyano-4,6-dimethyl-5-[(4-nitrophenyl)diazenyl]-2-pyridinyl] 2-chloroethanethioate?
The IUPAC name of S-[3-cyano-4,6-dimethyl-5-[(4-nitrophenyl)diazenyl]-2-pyridinyl] 2-chloroethanethioate (CID 102479730) is S-[3-cyano-4,6-dimethyl-5-[(4-nitrophenyl)diazenyl]-2-pyridinyl] 2-chloroethanethioate.
What is the SMILES notation for S-[3-cyano-4,6-dimethyl-5-[(4-nitrophenyl)diazenyl]-2-pyridinyl] 2-chloroethanethioate?
The canonical SMILES for S-[3-cyano-4,6-dimethyl-5-[(4-nitrophenyl)diazenyl]-2-pyridinyl] 2-chloroethanethioate is Cc1nc(SC(=O)CCl)c(C#N)c(C)c1/N=N/c1ccc([N+](=O)[O-])cc1.
What is the InChIKey of S-[3-cyano-4,6-dimethyl-5-[(4-nitrophenyl)diazenyl]-2-pyridinyl] 2-chloroethanethioate?
The InChIKey is XDKPVDUPLOHIRH-QZQOTICOSA-N. The full InChI is InChI=1S/C16H12ClN5O3S/c1-9-13(8-18)16(26-14(23)7-17)19-10(2)15(9)21-20-11-3-5-12(6-4-11)22(24)25/h3-6H,7H2,1-2H3/b21-20+.
What are the key properties of S-[3-cyano-4,6-dimethyl-5-[(4-nitrophenyl)diazenyl]-2-pyridinyl] 2-chloroethanethioate?
S-[3-cyano-4,6-dimethyl-5-[(4-nitrophenyl)diazenyl]-2-pyridinyl] 2-chloroethanethioate has a molecular weight of 389.82 g/mol, XLogP of 4.75, 5 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for S-[3-cyano-4,6-dimethyl-5-[(4-nitrophenyl)diazenyl]-2-pyridinyl] 2-chloroethanethioate is sourced from PubChem (CID 102479730), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).