C8H6ClN2NaO6 — CID 88733321
sodium;2-chloroacetate;1,4-dinitrobenzene (PubChem CID 88733321) has the molecular formula C8H6ClN2NaO6 and a molecular weight of 284.59 g/mol. Its IUPAC name is sodium;2-chloroacetate;1,4-dinitrobenzene.
| Compound Name | sodium;2-chloroacetate;1,4-dinitrobenzene |
|---|---|
| PubChem CID | 88733321 |
| Molecular Formula | C8H6ClN2NaO6 |
| Molecular Weight | 284.59 g/mol |
| Exact Mass | 283.98 |
| IUPAC Name | sodium;2-chloroacetate;1,4-dinitrobenzene |
| SMILES | O=C([O-])CCl.O=[N+]([O-])c1ccc([N+](=O)[O-])cc1.[Na+] |
| InChI | InChI=1S/C6H4N2O4.C2H3ClO2.Na/c9-7(10)5-1-2-6(4-3-5)8(11)12;3-1-2(4)5;/h1-4H;1H2,(H,4,5);/q;;+1/p-1 |
| InChIKey | YRYQKUJCHVOLOQ-UHFFFAOYSA-M |
| XLogP | -2.52 |
| TPSA | 126.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.59 |
| LogP ≤ 5 | -2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|