C8H4Cl3NO3 — CID 13050118
2,2,2-trichloro-1-(4-nitrophenyl)ethanone (PubChem CID 13050118) has the molecular formula C8H4Cl3NO3 and a molecular weight of 268.48 g/mol. Its IUPAC name is 2,2,2-trichloro-1-(4-nitrophenyl)ethanone.
| Compound Name | 2,2,2-trichloro-1-(4-nitrophenyl)ethanone |
|---|---|
| PubChem CID | 13050118 |
| Molecular Formula | C8H4Cl3NO3 |
| Molecular Weight | 268.48 g/mol |
| Exact Mass | 266.93 |
| IUPAC Name | 2,2,2-trichloro-1-(4-nitrophenyl)ethanone |
| SMILES | O=C(c1ccc([N+](=O)[O-])cc1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C8H4Cl3NO3/c9-8(10,11)7(13)5-1-3-6(4-2-5)12(14)15/h1-4H |
| InChIKey | GKFRYCVVNJVNNF-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 60.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.48 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|