C21H15ClN4O2 — CID 138858303
(3-cyano-4,6-dimethyl-5-phenyldiazenyl-2-pyridinyl) 4-chlorobenzoate (PubChem CID 138858303) has the molecular formula C21H15ClN4O2 and a molecular weight of 390.83 g/mol. Its IUPAC name is (3-cyano-4,6-dimethyl-5-phenyldiazenyl-2-pyridinyl) 4-chlorobenzoate.
| Compound Name | (3-cyano-4,6-dimethyl-5-phenyldiazenyl-2-pyridinyl) 4-chlorobenzoate |
|---|---|
| PubChem CID | 138858303 |
| Molecular Formula | C21H15ClN4O2 |
| Molecular Weight | 390.83 g/mol |
| Exact Mass | 390.09 |
| IUPAC Name | (3-cyano-4,6-dimethyl-5-phenyldiazenyl-2-pyridinyl) 4-chlorobenzoate |
| SMILES | Cc1nc(OC(=O)c2ccc(Cl)cc2)c(C#N)c(C)c1/N=N/c1ccccc1 |
| InChI | InChI=1S/C21H15ClN4O2/c1-13-18(12-23)20(28-21(27)15-8-10-16(22)11-9-15)24-14(2)19(13)26-25-17-6-4-3-5-7-17/h3-11H,1-2H3/b26-25+ |
| InChIKey | UVBOFKNOYYTKPL-OCEACIFDSA-N |
| XLogP | 5.86 |
| TPSA | 87.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.83 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|