C23H22ClN5O2S — CID 10552216
ethyl 2-[(4-chlorophenyl)carbamothioylamino]-4,6-dimethyl-5-phenyldiazenylpyridine-3-carboxylate (PubChem CID 10552216) has the molecular formula C23H22ClN5O2S and a molecular weight of 467.98 g/mol. Its IUPAC name is ethyl 2-[(4-chlorophenyl)carbamothioylamino]-4,6-dimethyl-5-phenyldiazenylpyridine-3-carboxylate.
| Compound Name | ethyl 2-[(4-chlorophenyl)carbamothioylamino]-4,6-dimethyl-5-phenyldiazenylpyridine-3-carboxylate |
|---|---|
| PubChem CID | 10552216 |
| Molecular Formula | C23H22ClN5O2S |
| Molecular Weight | 467.98 g/mol |
| Exact Mass | 467.12 |
| IUPAC Name | ethyl 2-[(4-chlorophenyl)carbamothioylamino]-4,6-dimethyl-5-phenyldiazenylpyridine-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=S)Nc2ccc(Cl)cc2)nc(C)c(/N=N/c2ccccc2)c1C |
| InChI | InChI=1S/C23H22ClN5O2S/c1-4-31-22(30)19-14(2)20(29-28-18-8-6-5-7-9-18)15(3)25-21(19)27-23(32)26-17-12-10-16(24)11-13-17/h5-13H,4H2,1-3H3,(H2,25,26,27,32)/b29-28+ |
| InChIKey | BOVLMBSQIRYPOU-ZQHSETAFSA-N |
| XLogP | 6.75 |
| TPSA | 87.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.98 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|