C16H17FN2O2S2 — CID 8728440
ethyl 2-[(4-fluorophenyl)carbamothioylamino]-4,5-dimethylthiophene-3-carboxylate (PubChem CID 8728440) has the molecular formula C16H17FN2O2S2 and a molecular weight of 352.46 g/mol. Its IUPAC name is ethyl 2-[(4-fluorophenyl)carbamothioylamino]-4,5-dimethylthiophene-3-carboxylate.
| Compound Name | ethyl 2-[(4-fluorophenyl)carbamothioylamino]-4,5-dimethylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 8728440 |
| Molecular Formula | C16H17FN2O2S2 |
| Molecular Weight | 352.46 g/mol |
| Exact Mass | 352.07 |
| IUPAC Name | ethyl 2-[(4-fluorophenyl)carbamothioylamino]-4,5-dimethylthiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=S)Nc2ccc(F)cc2)sc(C)c1C |
| InChI | InChI=1S/C16H17FN2O2S2/c1-4-21-15(20)13-9(2)10(3)23-14(13)19-16(22)18-12-7-5-11(17)6-8-12/h5-8H,4H2,1-3H3,(H2,18,19,22) |
| InChIKey | LNAXUHZNIQSHRL-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.46 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|