C14H14FN3OS2 — CID 681202
2-[(4-fluorophenyl)carbamothioylamino]-4,5-dimethylthiophene-3-carboxamide (PubChem CID 681202) has the molecular formula C14H14FN3OS2 and a molecular weight of 323.42 g/mol. Its IUPAC name is 2-[(4-fluorophenyl)carbamothioylamino]-4,5-dimethylthiophene-3-carboxamide.
| Compound Name | 2-[(4-fluorophenyl)carbamothioylamino]-4,5-dimethylthiophene-3-carboxamide |
|---|---|
| PubChem CID | 681202 |
| Molecular Formula | C14H14FN3OS2 |
| Molecular Weight | 323.42 g/mol |
| Exact Mass | 323.06 |
| IUPAC Name | 2-[(4-fluorophenyl)carbamothioylamino]-4,5-dimethylthiophene-3-carboxamide |
| SMILES | Cc1sc(NC(=S)Nc2ccc(F)cc2)c(C(N)=O)c1C |
| InChI | InChI=1S/C14H14FN3OS2/c1-7-8(2)21-13(11(7)12(16)19)18-14(20)17-10-5-3-9(15)4-6-10/h3-6H,1-2H3,(H2,16,19)(H2,17,18,20) |
| InChIKey | JOOGTKXESXSLHK-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.42 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|