C13H13N3O2S3 — CID 4311136
4,5-dimethyl-2-(thiophene-2-carbonylcarbamothioylamino)thiophene-3-carboxamide (PubChem CID 4311136) has the molecular formula C13H13N3O2S3 and a molecular weight of 339.47 g/mol. Its IUPAC name is 4,5-dimethyl-2-(thiophene-2-carbonylcarbamothioylamino)thiophene-3-carboxamide.
| Compound Name | 4,5-dimethyl-2-(thiophene-2-carbonylcarbamothioylamino)thiophene-3-carboxamide |
|---|---|
| PubChem CID | 4311136 |
| Molecular Formula | C13H13N3O2S3 |
| Molecular Weight | 339.47 g/mol |
| Exact Mass | 339.02 |
| IUPAC Name | 4,5-dimethyl-2-(thiophene-2-carbonylcarbamothioylamino)thiophene-3-carboxamide |
| SMILES | Cc1sc(NC(=S)NC(=O)c2cccs2)c(C(N)=O)c1C |
| InChI | InChI=1S/C13H13N3O2S3/c1-6-7(2)21-12(9(6)10(14)17)16-13(19)15-11(18)8-4-3-5-20-8/h3-5H,1-2H3,(H2,14,17)(H2,15,16,18,19) |
| InChIKey | YMLYAQAXDFZSAA-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.47 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|