C22H22N4O4S2 — CID 4144857
1-N,3-N-bis(3-carbamoyl-4,5-dimethylthiophen-2-yl)benzene-1,3-dicarboxamide (PubChem CID 4144857) has the molecular formula C22H22N4O4S2 and a molecular weight of 470.58 g/mol. Its IUPAC name is 1-N,3-N-bis(3-carbamoyl-4,5-dimethylthiophen-2-yl)benzene-1,3-dicarboxamide.
| Compound Name | 1-N,3-N-bis(3-carbamoyl-4,5-dimethylthiophen-2-yl)benzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 4144857 |
| Molecular Formula | C22H22N4O4S2 |
| Molecular Weight | 470.58 g/mol |
| Exact Mass | 470.11 |
| IUPAC Name | 1-N,3-N-bis(3-carbamoyl-4,5-dimethylthiophen-2-yl)benzene-1,3-dicarboxamide |
| SMILES | Cc1sc(NC(=O)c2cccc(C(=O)Nc3sc(C)c(C)c3C(N)=O)c2)c(C(N)=O)c1C |
| InChI | InChI=1S/C22H22N4O4S2/c1-9-11(3)31-21(15(9)17(23)27)25-19(29)13-6-5-7-14(8-13)20(30)26-22-16(18(24)28)10(2)12(4)32-22/h5-8H,1-4H3,(H2,23,27)(H2,24,28)(H,25,29)(H,26,30) |
| InChIKey | QBZKHDCDEBJBJO-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 144.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.58 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |