C21H18BrNO2S — CID 3165977
N-[3-(4-bromobenzoyl)-4,5-dimethylthiophen-2-yl]-3-methylbenzamide (PubChem CID 3165977) has the molecular formula C21H18BrNO2S and a molecular weight of 428.35 g/mol. Its IUPAC name is N-[3-(4-bromobenzoyl)-4,5-dimethylthiophen-2-yl]-3-methylbenzamide.
| Compound Name | N-[3-(4-bromobenzoyl)-4,5-dimethylthiophen-2-yl]-3-methylbenzamide |
|---|---|
| PubChem CID | 3165977 |
| Molecular Formula | C21H18BrNO2S |
| Molecular Weight | 428.35 g/mol |
| Exact Mass | 427.02 |
| IUPAC Name | N-[3-(4-bromobenzoyl)-4,5-dimethylthiophen-2-yl]-3-methylbenzamide |
| SMILES | Cc1cccc(C(=O)Nc2sc(C)c(C)c2C(=O)c2ccc(Br)cc2)c1 |
| InChI | InChI=1S/C21H18BrNO2S/c1-12-5-4-6-16(11-12)20(25)23-21-18(13(2)14(3)26-21)19(24)15-7-9-17(22)10-8-15/h4-11H,1-3H3,(H,23,25) |
| InChIKey | UYAMWHCOHOOQRX-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.35 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |