C20H15Br2NO2S — CID 3165980
4-bromo-N-[3-(4-bromobenzoyl)-4,5-dimethylthiophen-2-yl]benzamide (PubChem CID 3165980) has the molecular formula C20H15Br2NO2S and a molecular weight of 493.22 g/mol. Its IUPAC name is 4-bromo-N-[3-(4-bromobenzoyl)-4,5-dimethylthiophen-2-yl]benzamide.
| Compound Name | 4-bromo-N-[3-(4-bromobenzoyl)-4,5-dimethylthiophen-2-yl]benzamide |
|---|---|
| PubChem CID | 3165980 |
| Molecular Formula | C20H15Br2NO2S |
| Molecular Weight | 493.22 g/mol |
| Exact Mass | 490.92 |
| IUPAC Name | 4-bromo-N-[3-(4-bromobenzoyl)-4,5-dimethylthiophen-2-yl]benzamide |
| SMILES | Cc1sc(NC(=O)c2ccc(Br)cc2)c(C(=O)c2ccc(Br)cc2)c1C |
| InChI | InChI=1S/C20H15Br2NO2S/c1-11-12(2)26-20(23-19(25)14-5-9-16(22)10-6-14)17(11)18(24)13-3-7-15(21)8-4-13/h3-10H,1-2H3,(H,23,25) |
| InChIKey | NNEZNRPRETXWNT-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.22 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |