C14H13BrN2O2S — CID 1021509
2-[(2-bromobenzoyl)amino]-4,5-dimethylthiophene-3-carboxamide (PubChem CID 1021509) has the molecular formula C14H13BrN2O2S and a molecular weight of 353.24 g/mol. Its IUPAC name is 2-[(2-bromobenzoyl)amino]-4,5-dimethylthiophene-3-carboxamide.
| Compound Name | 2-[(2-bromobenzoyl)amino]-4,5-dimethylthiophene-3-carboxamide |
|---|---|
| PubChem CID | 1021509 |
| Molecular Formula | C14H13BrN2O2S |
| Molecular Weight | 353.24 g/mol |
| Exact Mass | 351.99 |
| IUPAC Name | 2-[(2-bromobenzoyl)amino]-4,5-dimethylthiophene-3-carboxamide |
| SMILES | Cc1sc(NC(=O)c2ccccc2Br)c(C(N)=O)c1C |
| InChI | InChI=1S/C14H13BrN2O2S/c1-7-8(2)20-14(11(7)12(16)18)17-13(19)9-5-3-4-6-10(9)15/h3-6H,1-2H3,(H2,16,18)(H,17,19) |
| InChIKey | JTOBUGIDZAZOJD-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.24 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |