C18H14BrNO3S — CID 1291201
ethyl 2-[(2-bromobenzoyl)amino]-1-benzothiophene-3-carboxylate (PubChem CID 1291201) has the molecular formula C18H14BrNO3S and a molecular weight of 404.29 g/mol. Its IUPAC name is ethyl 2-[(2-bromobenzoyl)amino]-1-benzothiophene-3-carboxylate.
| Compound Name | ethyl 2-[(2-bromobenzoyl)amino]-1-benzothiophene-3-carboxylate |
|---|---|
| PubChem CID | 1291201 |
| Molecular Formula | C18H14BrNO3S |
| Molecular Weight | 404.29 g/mol |
| Exact Mass | 402.99 |
| IUPAC Name | ethyl 2-[(2-bromobenzoyl)amino]-1-benzothiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)c2ccccc2Br)sc2ccccc12 |
| InChI | InChI=1S/C18H14BrNO3S/c1-2-23-18(22)15-12-8-4-6-10-14(12)24-17(15)20-16(21)11-7-3-5-9-13(11)19/h3-10H,2H2,1H3,(H,20,21) |
| InChIKey | VRCLTPAVCGIKES-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.29 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |