C21H21NO3S — CID 4102102
butyl 2-[(4-methylbenzoyl)amino]-1-benzothiophene-3-carboxylate (PubChem CID 4102102) has the molecular formula C21H21NO3S and a molecular weight of 367.47 g/mol. Its IUPAC name is butyl 2-[(4-methylbenzoyl)amino]-1-benzothiophene-3-carboxylate.
| Compound Name | butyl 2-[(4-methylbenzoyl)amino]-1-benzothiophene-3-carboxylate |
|---|---|
| PubChem CID | 4102102 |
| Molecular Formula | C21H21NO3S |
| Molecular Weight | 367.47 g/mol |
| Exact Mass | 367.12 |
| IUPAC Name | butyl 2-[(4-methylbenzoyl)amino]-1-benzothiophene-3-carboxylate |
| SMILES | CCCCOC(=O)c1c(NC(=O)c2ccc(C)cc2)sc2ccccc12 |
| InChI | InChI=1S/C21H21NO3S/c1-3-4-13-25-21(24)18-16-7-5-6-8-17(16)26-20(18)22-19(23)15-11-9-14(2)10-12-15/h5-12H,3-4,13H2,1-2H3,(H,22,23) |
| InChIKey | VQGNCMQYZRXXGQ-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.47 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|