C18H17NO3S2 — CID 4175884
butyl 2-(thiophene-2-carbonylamino)-1-benzothiophene-3-carboxylate (PubChem CID 4175884) has the molecular formula C18H17NO3S2 and a molecular weight of 359.47 g/mol. Its IUPAC name is butyl 2-(thiophene-2-carbonylamino)-1-benzothiophene-3-carboxylate.
| Compound Name | butyl 2-(thiophene-2-carbonylamino)-1-benzothiophene-3-carboxylate |
|---|---|
| PubChem CID | 4175884 |
| Molecular Formula | C18H17NO3S2 |
| Molecular Weight | 359.47 g/mol |
| Exact Mass | 359.06 |
| IUPAC Name | butyl 2-(thiophene-2-carbonylamino)-1-benzothiophene-3-carboxylate |
| SMILES | CCCCOC(=O)c1c(NC(=O)c2cccs2)sc2ccccc12 |
| InChI | InChI=1S/C18H17NO3S2/c1-2-3-10-22-18(21)15-12-7-4-5-8-13(12)24-17(15)19-16(20)14-9-6-11-23-14/h4-9,11H,2-3,10H2,1H3,(H,19,20) |
| InChIKey | JMFHBWKZQCWIFQ-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.47 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|