C20H17ClN2O5S — CID 4657021
butyl 2-[(2-chloro-5-nitrobenzoyl)amino]-1-benzothiophene-3-carboxylate (PubChem CID 4657021) has the molecular formula C20H17ClN2O5S and a molecular weight of 432.89 g/mol. Its IUPAC name is butyl 2-[(2-chloro-5-nitrobenzoyl)amino]-1-benzothiophene-3-carboxylate.
| Compound Name | butyl 2-[(2-chloro-5-nitrobenzoyl)amino]-1-benzothiophene-3-carboxylate |
|---|---|
| PubChem CID | 4657021 |
| Molecular Formula | C20H17ClN2O5S |
| Molecular Weight | 432.89 g/mol |
| Exact Mass | 432.05 |
| IUPAC Name | butyl 2-[(2-chloro-5-nitrobenzoyl)amino]-1-benzothiophene-3-carboxylate |
| SMILES | CCCCOC(=O)c1c(NC(=O)c2cc([N+](=O)[O-])ccc2Cl)sc2ccccc12 |
| InChI | InChI=1S/C20H17ClN2O5S/c1-2-3-10-28-20(25)17-13-6-4-5-7-16(13)29-19(17)22-18(24)14-11-12(23(26)27)8-9-15(14)21/h4-9,11H,2-3,10H2,1H3,(H,22,24) |
| InChIKey | SDEBRKLNJLCQQY-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.89 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|