C22H20ClNO3S — CID 3408112
butyl 2-[3-(3-chlorophenyl)prop-2-enoylamino]-1-benzothiophene-3-carboxylate (PubChem CID 3408112) has the molecular formula C22H20ClNO3S and a molecular weight of 413.93 g/mol. Its IUPAC name is butyl 2-[3-(3-chlorophenyl)prop-2-enoylamino]-1-benzothiophene-3-carboxylate.
| Compound Name | butyl 2-[3-(3-chlorophenyl)prop-2-enoylamino]-1-benzothiophene-3-carboxylate |
|---|---|
| PubChem CID | 3408112 |
| Molecular Formula | C22H20ClNO3S |
| Molecular Weight | 413.93 g/mol |
| Exact Mass | 413.09 |
| IUPAC Name | butyl 2-[3-(3-chlorophenyl)prop-2-enoylamino]-1-benzothiophene-3-carboxylate |
| SMILES | CCCCOC(=O)c1c(NC(=O)C=Cc2cccc(Cl)c2)sc2ccccc12 |
| InChI | InChI=1S/C22H20ClNO3S/c1-2-3-13-27-22(26)20-17-9-4-5-10-18(17)28-21(20)24-19(25)12-11-15-7-6-8-16(23)14-15/h4-12,14H,2-3,13H2,1H3,(H,24,25) |
| InChIKey | LPKPXWLPTMEDEB-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.93 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|