C24H25NO3S — CID 6075714
ethyl 2-[[(E)-3-(4-tert-butylphenyl)prop-2-enoyl]amino]-1-benzothiophene-3-carboxylate (PubChem CID 6075714) has the molecular formula C24H25NO3S and a molecular weight of 407.54 g/mol. Its IUPAC name is ethyl 2-[[(E)-3-(4-tert-butylphenyl)prop-2-enoyl]amino]-1-benzothiophene-3-carboxylate.
| Compound Name | ethyl 2-[[(E)-3-(4-tert-butylphenyl)prop-2-enoyl]amino]-1-benzothiophene-3-carboxylate |
|---|---|
| PubChem CID | 6075714 |
| Molecular Formula | C24H25NO3S |
| Molecular Weight | 407.54 g/mol |
| Exact Mass | 407.16 |
| IUPAC Name | ethyl 2-[[(E)-3-(4-tert-butylphenyl)prop-2-enoyl]amino]-1-benzothiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)/C=C/c2ccc(C(C)(C)C)cc2)sc2ccccc12 |
| InChI | InChI=1S/C24H25NO3S/c1-5-28-23(27)21-18-8-6-7-9-19(18)29-22(21)25-20(26)15-12-16-10-13-17(14-11-16)24(2,3)4/h6-15H,5H2,1-4H3,(H,25,26)/b15-12+ |
| InChIKey | DEORWPWBLRHRBF-NTCAYCPXSA-N |
| XLogP | 6.03 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.54 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|