C22H20FNO3S — CID 5083814
butyl 2-[3-(4-fluorophenyl)prop-2-enoylamino]-1-benzothiophene-3-carboxylate (PubChem CID 5083814) has the molecular formula C22H20FNO3S and a molecular weight of 397.47 g/mol. Its IUPAC name is butyl 2-[3-(4-fluorophenyl)prop-2-enoylamino]-1-benzothiophene-3-carboxylate.
| Compound Name | butyl 2-[3-(4-fluorophenyl)prop-2-enoylamino]-1-benzothiophene-3-carboxylate |
|---|---|
| PubChem CID | 5083814 |
| Molecular Formula | C22H20FNO3S |
| Molecular Weight | 397.47 g/mol |
| Exact Mass | 397.11 |
| IUPAC Name | butyl 2-[3-(4-fluorophenyl)prop-2-enoylamino]-1-benzothiophene-3-carboxylate |
| SMILES | CCCCOC(=O)c1c(NC(=O)C=Cc2ccc(F)cc2)sc2ccccc12 |
| InChI | InChI=1S/C22H20FNO3S/c1-2-3-14-27-22(26)20-17-6-4-5-7-18(17)28-21(20)24-19(25)13-10-15-8-11-16(23)12-9-15/h4-13H,2-3,14H2,1H3,(H,24,25) |
| InChIKey | KZQFJKJGGJXGKA-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.47 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|