C22H19ClFNO3S — CID 6258611
butyl 2-[[(E)-3-(2-chloro-6-fluorophenyl)prop-2-enoyl]amino]-1-benzothiophene-3-carboxylate (PubChem CID 6258611) has the molecular formula C22H19ClFNO3S and a molecular weight of 431.92 g/mol. Its IUPAC name is butyl 2-[[(E)-3-(2-chloro-6-fluorophenyl)prop-2-enoyl]amino]-1-benzothiophene-3-carboxylate.
| Compound Name | butyl 2-[[(E)-3-(2-chloro-6-fluorophenyl)prop-2-enoyl]amino]-1-benzothiophene-3-carboxylate |
|---|---|
| PubChem CID | 6258611 |
| Molecular Formula | C22H19ClFNO3S |
| Molecular Weight | 431.92 g/mol |
| Exact Mass | 431.08 |
| IUPAC Name | butyl 2-[[(E)-3-(2-chloro-6-fluorophenyl)prop-2-enoyl]amino]-1-benzothiophene-3-carboxylate |
| SMILES | CCCCOC(=O)c1c(NC(=O)/C=C/c2c(F)cccc2Cl)sc2ccccc12 |
| InChI | InChI=1S/C22H19ClFNO3S/c1-2-3-13-28-22(27)20-15-7-4-5-10-18(15)29-21(20)25-19(26)12-11-14-16(23)8-6-9-17(14)24/h4-12H,2-3,13H2,1H3,(H,25,26)/b12-11+ |
| InChIKey | NCPUGZFNNSHICS-VAWYXSNFSA-N |
| XLogP | 6.30 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.92 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|