C22H14ClF16NO3S — CID 4085440
butyl 2-[(9-chloro-2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-hexadecafluorononanoyl)amino]-1-benzothiophene-3-carboxylate (PubChem CID 4085440) has the molecular formula C22H14ClF16NO3S and a molecular weight of 711.85 g/mol. Its IUPAC name is butyl 2-[(9-chloro-2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-hexadecafluorononanoyl)amino]-1-benzothiophene-3-carboxylate.
| Compound Name | butyl 2-[(9-chloro-2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-hexadecafluorononanoyl)amino]-1-benzothiophene-3-carboxylate |
|---|---|
| PubChem CID | 4085440 |
| Molecular Formula | C22H14ClF16NO3S |
| Molecular Weight | 711.85 g/mol |
| Exact Mass | 711.01 |
| IUPAC Name | butyl 2-[(9-chloro-2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-hexadecafluorononanoyl)amino]-1-benzothiophene-3-carboxylate |
| SMILES | CCCCOC(=O)c1c(NC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)Cl)sc2ccccc12 |
| InChI | InChI=1S/C22H14ClF16NO3S/c1-2-3-8-43-13(41)11-9-6-4-5-7-10(9)44-12(11)40-14(42)15(24,25)16(26,27)17(28,29)18(30,31)19(32,33)20(34,35)21(36,37)22(23,38)39/h4-7H,2-3,8H2,1H3,(H,40,42) |
| InChIKey | JYIHJRFEBNKCET-UHFFFAOYSA-N |
| XLogP | 9.08 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 711.85 |
| LogP ≤ 5 | 9.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|