C22H22ClNO4S — CID 3363175
butyl 2-[[2-(4-chloro-2-methylphenoxy)acetyl]amino]-1-benzothiophene-3-carboxylate (PubChem CID 3363175) has the molecular formula C22H22ClNO4S and a molecular weight of 431.94 g/mol. Its IUPAC name is butyl 2-[[2-(4-chloro-2-methylphenoxy)acetyl]amino]-1-benzothiophene-3-carboxylate.
| Compound Name | butyl 2-[[2-(4-chloro-2-methylphenoxy)acetyl]amino]-1-benzothiophene-3-carboxylate |
|---|---|
| PubChem CID | 3363175 |
| Molecular Formula | C22H22ClNO4S |
| Molecular Weight | 431.94 g/mol |
| Exact Mass | 431.10 |
| IUPAC Name | butyl 2-[[2-(4-chloro-2-methylphenoxy)acetyl]amino]-1-benzothiophene-3-carboxylate |
| SMILES | CCCCOC(=O)c1c(NC(=O)COc2ccc(Cl)cc2C)sc2ccccc12 |
| InChI | InChI=1S/C22H22ClNO4S/c1-3-4-11-27-22(26)20-16-7-5-6-8-18(16)29-21(20)24-19(25)13-28-17-10-9-15(23)12-14(17)2/h5-10,12H,3-4,11,13H2,1-2H3,(H,24,25) |
| InChIKey | UXMIGQCNBIIHKS-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.94 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|