C20H17Cl2NO3S — CID 3379119
butyl 2-[(2,6-dichlorobenzoyl)amino]-1-benzothiophene-3-carboxylate (PubChem CID 3379119) has the molecular formula C20H17Cl2NO3S and a molecular weight of 422.33 g/mol. Its IUPAC name is butyl 2-[(2,6-dichlorobenzoyl)amino]-1-benzothiophene-3-carboxylate.
| Compound Name | butyl 2-[(2,6-dichlorobenzoyl)amino]-1-benzothiophene-3-carboxylate |
|---|---|
| PubChem CID | 3379119 |
| Molecular Formula | C20H17Cl2NO3S |
| Molecular Weight | 422.33 g/mol |
| Exact Mass | 421.03 |
| IUPAC Name | butyl 2-[(2,6-dichlorobenzoyl)amino]-1-benzothiophene-3-carboxylate |
| SMILES | CCCCOC(=O)c1c(NC(=O)c2c(Cl)cccc2Cl)sc2ccccc12 |
| InChI | InChI=1S/C20H17Cl2NO3S/c1-2-3-11-26-20(25)16-12-7-4-5-10-15(12)27-19(16)23-18(24)17-13(21)8-6-9-14(17)22/h4-10H,2-3,11H2,1H3,(H,23,24) |
| InChIKey | JPMZWDNAPSKAQB-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.33 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|