C29H24N2O3S — CID 4591939
butyl 2-[(2-phenylquinoline-4-carbonyl)amino]-1-benzothiophene-3-carboxylate (PubChem CID 4591939) has the molecular formula C29H24N2O3S and a molecular weight of 480.59 g/mol. Its IUPAC name is butyl 2-[(2-phenylquinoline-4-carbonyl)amino]-1-benzothiophene-3-carboxylate.
| Compound Name | butyl 2-[(2-phenylquinoline-4-carbonyl)amino]-1-benzothiophene-3-carboxylate |
|---|---|
| PubChem CID | 4591939 |
| Molecular Formula | C29H24N2O3S |
| Molecular Weight | 480.59 g/mol |
| Exact Mass | 480.15 |
| IUPAC Name | butyl 2-[(2-phenylquinoline-4-carbonyl)amino]-1-benzothiophene-3-carboxylate |
| SMILES | CCCCOC(=O)c1c(NC(=O)c2cc(-c3ccccc3)nc3ccccc23)sc2ccccc12 |
| InChI | InChI=1S/C29H24N2O3S/c1-2-3-17-34-29(33)26-21-14-8-10-16-25(21)35-28(26)31-27(32)22-18-24(19-11-5-4-6-12-19)30-23-15-9-7-13-20(22)23/h4-16,18H,2-3,17H2,1H3,(H,31,32) |
| InChIKey | JHNWWRDALPIOHG-UHFFFAOYSA-N |
| XLogP | 7.33 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.59 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|