C30H26N2O3S — CID 4298118
butyl 2-[[2-(3-methylphenyl)quinoline-4-carbonyl]amino]-1-benzothiophene-3-carboxylate (PubChem CID 4298118) has the molecular formula C30H26N2O3S and a molecular weight of 494.62 g/mol. Its IUPAC name is butyl 2-[[2-(3-methylphenyl)quinoline-4-carbonyl]amino]-1-benzothiophene-3-carboxylate.
| Compound Name | butyl 2-[[2-(3-methylphenyl)quinoline-4-carbonyl]amino]-1-benzothiophene-3-carboxylate |
|---|---|
| PubChem CID | 4298118 |
| Molecular Formula | C30H26N2O3S |
| Molecular Weight | 494.62 g/mol |
| Exact Mass | 494.17 |
| IUPAC Name | butyl 2-[[2-(3-methylphenyl)quinoline-4-carbonyl]amino]-1-benzothiophene-3-carboxylate |
| SMILES | CCCCOC(=O)c1c(NC(=O)c2cc(-c3cccc(C)c3)nc3ccccc23)sc2ccccc12 |
| InChI | InChI=1S/C30H26N2O3S/c1-3-4-16-35-30(34)27-22-13-6-8-15-26(22)36-29(27)32-28(33)23-18-25(20-11-9-10-19(2)17-20)31-24-14-7-5-12-21(23)24/h5-15,17-18H,3-4,16H2,1-2H3,(H,32,33) |
| InChIKey | UOSLVAIGGSQZDF-UHFFFAOYSA-N |
| XLogP | 7.63 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.62 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|