C32H28N2O4S — CID 17384714
methyl 5-methyl-4-phenyl-2-[[2-(3-propoxyphenyl)quinoline-4-carbonyl]amino]thiophene-3-carboxylate (PubChem CID 17384714) has the molecular formula C32H28N2O4S and a molecular weight of 536.65 g/mol. Its IUPAC name is methyl 5-methyl-4-phenyl-2-[[2-(3-propoxyphenyl)quinoline-4-carbonyl]amino]thiophene-3-carboxylate.
| Compound Name | methyl 5-methyl-4-phenyl-2-[[2-(3-propoxyphenyl)quinoline-4-carbonyl]amino]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 17384714 |
| Molecular Formula | C32H28N2O4S |
| Molecular Weight | 536.65 g/mol |
| Exact Mass | 536.18 |
| IUPAC Name | methyl 5-methyl-4-phenyl-2-[[2-(3-propoxyphenyl)quinoline-4-carbonyl]amino]thiophene-3-carboxylate |
| SMILES | CCCOc1cccc(-c2cc(C(=O)Nc3sc(C)c(-c4ccccc4)c3C(=O)OC)c3ccccc3n2)c1 |
| InChI | InChI=1S/C32H28N2O4S/c1-4-17-38-23-14-10-13-22(18-23)27-19-25(24-15-8-9-16-26(24)33-27)30(35)34-31-29(32(36)37-3)28(20(2)39-31)21-11-6-5-7-12-21/h5-16,18-19H,4,17H2,1-3H3,(H,34,35) |
| InChIKey | ZRDOGNKZIUSTRK-UHFFFAOYSA-N |
| XLogP | 7.77 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.65 |
| LogP ≤ 5 | 7.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|