C36H36N2O4S — CID 17384750
ethyl 5-methyl-4-(4-propan-2-ylphenyl)-2-[[2-(3-propoxyphenyl)quinoline-4-carbonyl]amino]thiophene-3-carboxylate (PubChem CID 17384750) has the molecular formula C36H36N2O4S and a molecular weight of 592.76 g/mol. Its IUPAC name is ethyl 5-methyl-4-(4-propan-2-ylphenyl)-2-[[2-(3-propoxyphenyl)quinoline-4-carbonyl]amino]thiophene-3-carboxylate.
| Compound Name | ethyl 5-methyl-4-(4-propan-2-ylphenyl)-2-[[2-(3-propoxyphenyl)quinoline-4-carbonyl]amino]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 17384750 |
| Molecular Formula | C36H36N2O4S |
| Molecular Weight | 592.76 g/mol |
| Exact Mass | 592.24 |
| IUPAC Name | ethyl 5-methyl-4-(4-propan-2-ylphenyl)-2-[[2-(3-propoxyphenyl)quinoline-4-carbonyl]amino]thiophene-3-carboxylate |
| SMILES | CCCOc1cccc(-c2cc(C(=O)Nc3sc(C)c(-c4ccc(C(C)C)cc4)c3C(=O)OCC)c3ccccc3n2)c1 |
| InChI | InChI=1S/C36H36N2O4S/c1-6-19-42-27-12-10-11-26(20-27)31-21-29(28-13-8-9-14-30(28)37-31)34(39)38-35-33(36(40)41-7-2)32(23(5)43-35)25-17-15-24(16-18-25)22(3)4/h8-18,20-22H,6-7,19H2,1-5H3,(H,38,39) |
| InChIKey | HMHFRUDMRSCSAA-UHFFFAOYSA-N |
| XLogP | 9.28 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.76 |
| LogP ≤ 5 | 9.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|