C35H32N2O5S — CID 4633361
methyl 2-[[2-(3-butoxyphenyl)quinoline-4-carbonyl]amino]-7-methoxy-4,5-dihydrobenzo[e][1]benzothiole-1-carboxylate (PubChem CID 4633361) has the molecular formula C35H32N2O5S and a molecular weight of 592.72 g/mol. Its IUPAC name is methyl 2-[[2-(3-butoxyphenyl)quinoline-4-carbonyl]amino]-7-methoxy-4,5-dihydrobenzo[e][1]benzothiole-1-carboxylate.
| Compound Name | methyl 2-[[2-(3-butoxyphenyl)quinoline-4-carbonyl]amino]-7-methoxy-4,5-dihydrobenzo[e][1]benzothiole-1-carboxylate |
|---|---|
| PubChem CID | 4633361 |
| Molecular Formula | C35H32N2O5S |
| Molecular Weight | 592.72 g/mol |
| Exact Mass | 592.20 |
| IUPAC Name | methyl 2-[[2-(3-butoxyphenyl)quinoline-4-carbonyl]amino]-7-methoxy-4,5-dihydrobenzo[e][1]benzothiole-1-carboxylate |
| SMILES | CCCCOc1cccc(-c2cc(C(=O)Nc3sc4c(c3C(=O)OC)-c3ccc(OC)cc3CC4)c3ccccc3n2)c1 |
| InChI | InChI=1S/C35H32N2O5S/c1-4-5-17-42-24-10-8-9-22(19-24)29-20-27(26-11-6-7-12-28(26)36-29)33(38)37-34-32(35(39)41-3)31-25-15-14-23(40-2)18-21(25)13-16-30(31)43-34/h6-12,14-15,18-20H,4-5,13,16-17H2,1-3H3,(H,37,38) |
| InChIKey | LXHGYKTVJNFWOL-UHFFFAOYSA-N |
| XLogP | 7.96 |
| TPSA | 86.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.72 |
| LogP ≤ 5 | 7.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|