C28H30N2O4S — CID 3810464
ethyl 2-[3-(4-tert-butylphenyl)prop-2-enoylamino]-4-methyl-5-(phenylcarbamoyl)thiophene-3-carboxylate (PubChem CID 3810464) has the molecular formula C28H30N2O4S and a molecular weight of 490.63 g/mol. Its IUPAC name is ethyl 2-[3-(4-tert-butylphenyl)prop-2-enoylamino]-4-methyl-5-(phenylcarbamoyl)thiophene-3-carboxylate.
| Compound Name | ethyl 2-[3-(4-tert-butylphenyl)prop-2-enoylamino]-4-methyl-5-(phenylcarbamoyl)thiophene-3-carboxylate |
|---|---|
| PubChem CID | 3810464 |
| Molecular Formula | C28H30N2O4S |
| Molecular Weight | 490.63 g/mol |
| Exact Mass | 490.19 |
| IUPAC Name | ethyl 2-[3-(4-tert-butylphenyl)prop-2-enoylamino]-4-methyl-5-(phenylcarbamoyl)thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)C=Cc2ccc(C(C)(C)C)cc2)sc(C(=O)Nc2ccccc2)c1C |
| InChI | InChI=1S/C28H30N2O4S/c1-6-34-27(33)23-18(2)24(25(32)29-21-10-8-7-9-11-21)35-26(23)30-22(31)17-14-19-12-15-20(16-13-19)28(3,4)5/h7-17H,6H2,1-5H3,(H,29,32)(H,30,31) |
| InChIKey | KOHTZRHMUIVFRN-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.63 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|