C15H14FN3O2S2 — CID 4950387
2-[(2-fluorobenzoyl)carbamothioylamino]-4,5-dimethylthiophene-3-carboxamide (PubChem CID 4950387) has the molecular formula C15H14FN3O2S2 and a molecular weight of 351.43 g/mol. Its IUPAC name is 2-[(2-fluorobenzoyl)carbamothioylamino]-4,5-dimethylthiophene-3-carboxamide.
| Compound Name | 2-[(2-fluorobenzoyl)carbamothioylamino]-4,5-dimethylthiophene-3-carboxamide |
|---|---|
| PubChem CID | 4950387 |
| Molecular Formula | C15H14FN3O2S2 |
| Molecular Weight | 351.43 g/mol |
| Exact Mass | 351.05 |
| IUPAC Name | 2-[(2-fluorobenzoyl)carbamothioylamino]-4,5-dimethylthiophene-3-carboxamide |
| SMILES | Cc1sc(NC(=S)NC(=O)c2ccccc2F)c(C(N)=O)c1C |
| InChI | InChI=1S/C15H14FN3O2S2/c1-7-8(2)23-14(11(7)12(17)20)19-15(22)18-13(21)9-5-3-4-6-10(9)16/h3-6H,1-2H3,(H2,17,20)(H2,18,19,21,22) |
| InChIKey | MDXDHTUFUURYFN-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.43 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|