C12H11FN4OS2 — CID 54787169
N-[(5-ethyl-1,3,4-thiadiazol-2-yl)carbamothioyl]-2-fluorobenzamide (PubChem CID 54787169) has the molecular formula C12H11FN4OS2 and a molecular weight of 310.38 g/mol. Its IUPAC name is N-[(5-ethyl-1,3,4-thiadiazol-2-yl)carbamothioyl]-2-fluorobenzamide.
| Compound Name | N-[(5-ethyl-1,3,4-thiadiazol-2-yl)carbamothioyl]-2-fluorobenzamide |
|---|---|
| PubChem CID | 54787169 |
| Molecular Formula | C12H11FN4OS2 |
| Molecular Weight | 310.38 g/mol |
| Exact Mass | 310.04 |
| IUPAC Name | N-[(5-ethyl-1,3,4-thiadiazol-2-yl)carbamothioyl]-2-fluorobenzamide |
| SMILES | CCc1nnc(NC(=S)NC(=O)c2ccccc2F)s1 |
| InChI | InChI=1S/C12H11FN4OS2/c1-2-9-16-17-12(20-9)15-11(19)14-10(18)7-5-3-4-6-8(7)13/h3-6H,2H2,1H3,(H2,14,15,17,18,19) |
| InChIKey | ZMCBPCLHUGJNND-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.38 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|