C16H19BrN4O2S2 — CID 54787240
5-bromo-2-butoxy-N-[(5-ethyl-1,3,4-thiadiazol-2-yl)carbamothioyl]benzamide (PubChem CID 54787240) has the molecular formula C16H19BrN4O2S2 and a molecular weight of 443.39 g/mol. Its IUPAC name is 5-bromo-2-butoxy-N-[(5-ethyl-1,3,4-thiadiazol-2-yl)carbamothioyl]benzamide.
| Compound Name | 5-bromo-2-butoxy-N-[(5-ethyl-1,3,4-thiadiazol-2-yl)carbamothioyl]benzamide |
|---|---|
| PubChem CID | 54787240 |
| Molecular Formula | C16H19BrN4O2S2 |
| Molecular Weight | 443.39 g/mol |
| Exact Mass | 442.01 |
| IUPAC Name | 5-bromo-2-butoxy-N-[(5-ethyl-1,3,4-thiadiazol-2-yl)carbamothioyl]benzamide |
| SMILES | CCCCOc1ccc(Br)cc1C(=O)NC(=S)Nc1nnc(CC)s1 |
| InChI | InChI=1S/C16H19BrN4O2S2/c1-3-5-8-23-12-7-6-10(17)9-11(12)14(22)18-15(24)19-16-21-20-13(4-2)25-16/h6-7,9H,3-5,8H2,1-2H3,(H2,18,19,21,22,24) |
| InChIKey | YYSDKUBETBDPDC-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.39 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|