C19H25FN4O2S — CID 55551720
2-fluoro-N-[2-[(5-octyl-1,3,4-thiadiazol-2-yl)amino]-2-oxoethyl]benzamide (PubChem CID 55551720) has the molecular formula C19H25FN4O2S and a molecular weight of 392.50 g/mol. Its IUPAC name is 2-fluoro-N-[2-[(5-octyl-1,3,4-thiadiazol-2-yl)amino]-2-oxoethyl]benzamide.
| Compound Name | 2-fluoro-N-[2-[(5-octyl-1,3,4-thiadiazol-2-yl)amino]-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 55551720 |
| Molecular Formula | C19H25FN4O2S |
| Molecular Weight | 392.50 g/mol |
| Exact Mass | 392.17 |
| IUPAC Name | 2-fluoro-N-[2-[(5-octyl-1,3,4-thiadiazol-2-yl)amino]-2-oxoethyl]benzamide |
| SMILES | CCCCCCCCc1nnc(NC(=O)CNC(=O)c2ccccc2F)s1 |
| InChI | InChI=1S/C19H25FN4O2S/c1-2-3-4-5-6-7-12-17-23-24-19(27-17)22-16(25)13-21-18(26)14-10-8-9-11-15(14)20/h8-11H,2-7,12-13H2,1H3,(H,21,26)(H,22,24,25) |
| InChIKey | NGCOAUZCLVLRLJ-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.50 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|