C15H17ClN4O2S — CID 17193600
N-[2-[5-(butanoylamino)-1,3,4-thiadiazol-2-yl]ethyl]-2-chlorobenzamide (PubChem CID 17193600) has the molecular formula C15H17ClN4O2S and a molecular weight of 352.85 g/mol. Its IUPAC name is N-[2-[5-(butanoylamino)-1,3,4-thiadiazol-2-yl]ethyl]-2-chlorobenzamide.
| Compound Name | N-[2-[5-(butanoylamino)-1,3,4-thiadiazol-2-yl]ethyl]-2-chlorobenzamide |
|---|---|
| PubChem CID | 17193600 |
| Molecular Formula | C15H17ClN4O2S |
| Molecular Weight | 352.85 g/mol |
| Exact Mass | 352.08 |
| IUPAC Name | N-[2-[5-(butanoylamino)-1,3,4-thiadiazol-2-yl]ethyl]-2-chlorobenzamide |
| SMILES | CCCC(=O)Nc1nnc(CCNC(=O)c2ccccc2Cl)s1 |
| InChI | InChI=1S/C15H17ClN4O2S/c1-2-5-12(21)18-15-20-19-13(23-15)8-9-17-14(22)10-6-3-4-7-11(10)16/h3-4,6-7H,2,5,8-9H2,1H3,(H,17,22)(H,18,20,21) |
| InChIKey | RQNVUINFCUMBMJ-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.85 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |