C18H13ClN6O6S — CID 17193084
N-[5-[2-[(2-chlorobenzoyl)amino]ethyl]-1,3,4-thiadiazol-2-yl]-3,5-dinitrobenzamide (PubChem CID 17193084) has the molecular formula C18H13ClN6O6S and a molecular weight of 476.86 g/mol. Its IUPAC name is N-[5-[2-[(2-chlorobenzoyl)amino]ethyl]-1,3,4-thiadiazol-2-yl]-3,5-dinitrobenzamide.
| Compound Name | N-[5-[2-[(2-chlorobenzoyl)amino]ethyl]-1,3,4-thiadiazol-2-yl]-3,5-dinitrobenzamide |
|---|---|
| PubChem CID | 17193084 |
| Molecular Formula | C18H13ClN6O6S |
| Molecular Weight | 476.86 g/mol |
| Exact Mass | 476.03 |
| IUPAC Name | N-[5-[2-[(2-chlorobenzoyl)amino]ethyl]-1,3,4-thiadiazol-2-yl]-3,5-dinitrobenzamide |
| SMILES | O=C(Nc1nnc(CCNC(=O)c2ccccc2Cl)s1)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C18H13ClN6O6S/c19-14-4-2-1-3-13(14)17(27)20-6-5-15-22-23-18(32-15)21-16(26)10-7-11(24(28)29)9-12(8-10)25(30)31/h1-4,7-9H,5-6H2,(H,20,27)(H,21,23,26) |
| InChIKey | XBIWIFPAAVALJA-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 170.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.86 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|