C14H9ClN4O6 — CID 4508937
N'-(2-chlorobenzoyl)-3,5-dinitrobenzohydrazide (PubChem CID 4508937) has the molecular formula C14H9ClN4O6 and a molecular weight of 364.70 g/mol. Its IUPAC name is N'-(2-chlorobenzoyl)-3,5-dinitrobenzohydrazide.
| Compound Name | N'-(2-chlorobenzoyl)-3,5-dinitrobenzohydrazide |
|---|---|
| PubChem CID | 4508937 |
| Molecular Formula | C14H9ClN4O6 |
| Molecular Weight | 364.70 g/mol |
| Exact Mass | 364.02 |
| IUPAC Name | N'-(2-chlorobenzoyl)-3,5-dinitrobenzohydrazide |
| SMILES | O=C(NNC(=O)c1ccccc1Cl)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C14H9ClN4O6/c15-12-4-2-1-3-11(12)14(21)17-16-13(20)8-5-9(18(22)23)7-10(6-8)19(24)25/h1-7H,(H,16,20)(H,17,21) |
| InChIKey | DDRDUVPNVOKULS-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 144.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.70 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|