C13H10N4O5 — CID 78774569
3,5-dinitro-N'-phenylbenzohydrazide (PubChem CID 78774569) has the molecular formula C13H10N4O5 and a molecular weight of 302.25 g/mol. Its IUPAC name is 3,5-dinitro-N'-phenylbenzohydrazide.
| Compound Name | 3,5-dinitro-N'-phenylbenzohydrazide |
|---|---|
| PubChem CID | 78774569 |
| Molecular Formula | C13H10N4O5 |
| Molecular Weight | 302.25 g/mol |
| Exact Mass | 302.07 |
| IUPAC Name | 3,5-dinitro-N'-phenylbenzohydrazide |
| SMILES | O=C(NNc1ccccc1)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C13H10N4O5/c18-13(15-14-10-4-2-1-3-5-10)9-6-11(16(19)20)8-12(7-9)17(21)22/h1-8,14H,(H,15,18) |
| InChIKey | SNAVNSRHCZNSNX-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 127.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.25 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|