C21H17N5O9S — CID 4215032
methyl 3-nitro-5-[[2-nitro-4-(phenylsulfamoyl)anilino]carbamoyl]benzoate (PubChem CID 4215032) has the molecular formula C21H17N5O9S and a molecular weight of 515.46 g/mol. Its IUPAC name is methyl 3-nitro-5-[[2-nitro-4-(phenylsulfamoyl)anilino]carbamoyl]benzoate.
| Compound Name | methyl 3-nitro-5-[[2-nitro-4-(phenylsulfamoyl)anilino]carbamoyl]benzoate |
|---|---|
| PubChem CID | 4215032 |
| Molecular Formula | C21H17N5O9S |
| Molecular Weight | 515.46 g/mol |
| Exact Mass | 515.07 |
| IUPAC Name | methyl 3-nitro-5-[[2-nitro-4-(phenylsulfamoyl)anilino]carbamoyl]benzoate |
| SMILES | COC(=O)c1cc(C(=O)NNc2ccc(S(=O)(=O)Nc3ccccc3)cc2[N+](=O)[O-])cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C21H17N5O9S/c1-35-21(28)14-9-13(10-16(11-14)25(29)30)20(27)23-22-18-8-7-17(12-19(18)26(31)32)36(33,34)24-15-5-3-2-4-6-15/h2-12,22,24H,1H3,(H,23,27) |
| InChIKey | SUZFKANDNULJHV-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 199.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.46 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|