C16H17N3O6 — CID 3705652
3,4,5-trimethoxy-N'-(4-nitrophenyl)benzohydrazide (PubChem CID 3705652) has the molecular formula C16H17N3O6 and a molecular weight of 347.33 g/mol. Its IUPAC name is 3,4,5-trimethoxy-N'-(4-nitrophenyl)benzohydrazide.
| Compound Name | 3,4,5-trimethoxy-N'-(4-nitrophenyl)benzohydrazide |
|---|---|
| PubChem CID | 3705652 |
| Molecular Formula | C16H17N3O6 |
| Molecular Weight | 347.33 g/mol |
| Exact Mass | 347.11 |
| IUPAC Name | 3,4,5-trimethoxy-N'-(4-nitrophenyl)benzohydrazide |
| SMILES | COc1cc(C(=O)NNc2ccc([N+](=O)[O-])cc2)cc(OC)c1OC |
| InChI | InChI=1S/C16H17N3O6/c1-23-13-8-10(9-14(24-2)15(13)25-3)16(20)18-17-11-4-6-12(7-5-11)19(21)22/h4-9,17H,1-3H3,(H,18,20) |
| InChIKey | HIUPEKVVWBAMKG-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 111.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.33 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|