C19H17N5O6 — CID 4152971
2-(4,6-dimethoxypyrimidin-2-yl)oxy-N'-(4-nitrophenyl)benzohydrazide (PubChem CID 4152971) has the molecular formula C19H17N5O6 and a molecular weight of 411.37 g/mol. Its IUPAC name is 2-(4,6-dimethoxypyrimidin-2-yl)oxy-N'-(4-nitrophenyl)benzohydrazide.
| Compound Name | 2-(4,6-dimethoxypyrimidin-2-yl)oxy-N'-(4-nitrophenyl)benzohydrazide |
|---|---|
| PubChem CID | 4152971 |
| Molecular Formula | C19H17N5O6 |
| Molecular Weight | 411.37 g/mol |
| Exact Mass | 411.12 |
| IUPAC Name | 2-(4,6-dimethoxypyrimidin-2-yl)oxy-N'-(4-nitrophenyl)benzohydrazide |
| SMILES | COc1cc(OC)nc(Oc2ccccc2C(=O)NNc2ccc([N+](=O)[O-])cc2)n1 |
| InChI | InChI=1S/C19H17N5O6/c1-28-16-11-17(29-2)21-19(20-16)30-15-6-4-3-5-14(15)18(25)23-22-12-7-9-13(10-8-12)24(26)27/h3-11,22H,1-2H3,(H,23,25) |
| InChIKey | LLQMSEPXLUXGAD-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 137.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.37 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|