C13H12N2O4S — CID 88600635
2-(4,6-dimethoxypyrimidin-2-yl)oxybenzenecarbothioic S-acid (PubChem CID 88600635) has the molecular formula C13H12N2O4S and a molecular weight of 292.32 g/mol. Its IUPAC name is 2-(4,6-dimethoxypyrimidin-2-yl)oxybenzenecarbothioic S-acid.
| Compound Name | 2-(4,6-dimethoxypyrimidin-2-yl)oxybenzenecarbothioic S-acid |
|---|---|
| PubChem CID | 88600635 |
| Molecular Formula | C13H12N2O4S |
| Molecular Weight | 292.32 g/mol |
| Exact Mass | 292.05 |
| IUPAC Name | 2-(4,6-dimethoxypyrimidin-2-yl)oxybenzenecarbothioic S-acid |
| SMILES | COc1cc(OC)nc(Oc2ccccc2C(=O)S)n1 |
| InChI | InChI=1S/C13H12N2O4S/c1-17-10-7-11(18-2)15-13(14-10)19-9-6-4-3-5-8(9)12(16)20/h3-7H,1-2H3,(H,16,20) |
| InChIKey | ARKVVLFNOCOBHZ-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 70.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.32 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|