About 2-(4,6-dimethoxypyrimidin-2-yl)oxy-6-phenylbenzenecarbothioic S-acid
2-(4,6-dimethoxypyrimidin-2-yl)oxy-6-phenylbenzenecarbothioic S-acid (PubChem CID 19901305) has the molecular formula C19H16N2O4S
and a molecular weight of 368.41 g/mol. Its IUPAC name is 2-(4,6-dimethoxypyrimidin-2-yl)oxy-6-phenylbenzenecarbothioic S-acid.
Molecular Properties
| Compound Name | 2-(4,6-dimethoxypyrimidin-2-yl)oxy-6-phenylbenzenecarbothioic S-acid |
| PubChem CID | 19901305 |
| Molecular Formula | C19H16N2O4S |
| Molecular Weight | 368.41 g/mol |
| Exact Mass | 368.08 |
| IUPAC Name | 2-(4,6-dimethoxypyrimidin-2-yl)oxy-6-phenylbenzenecarbothioic S-acid |
| SMILES | COc1cc(OC)nc(Oc2cccc(-c3ccccc3)c2C(=O)S)n1 |
| InChI | InChI=1S/C19H16N2O4S/c1-23-15-11-16(24-2)21-19(20-15)25-14-10-6-9-13(17(14)18(22)26)12-7-4-3-5-8-12/h3-11H,1-2H3,(H,22,26) |
| InChIKey | BFFRRIQZQIISDK-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 70.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 368.41 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 2-(4,6-dimethoxypyrimidin-2-yl)oxy-6-phenylbenzenecarbothioic S-acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4,6-dimethoxypyrimidin-2-yl)oxy-6-phenylbenzenecarbothioic S-acid?
The IUPAC name of 2-(4,6-dimethoxypyrimidin-2-yl)oxy-6-phenylbenzenecarbothioic S-acid (CID 19901305) is 2-(4,6-dimethoxypyrimidin-2-yl)oxy-6-phenylbenzenecarbothioic S-acid.
What is the SMILES notation for 2-(4,6-dimethoxypyrimidin-2-yl)oxy-6-phenylbenzenecarbothioic S-acid?
The canonical SMILES for 2-(4,6-dimethoxypyrimidin-2-yl)oxy-6-phenylbenzenecarbothioic S-acid is COc1cc(OC)nc(Oc2cccc(-c3ccccc3)c2C(=O)S)n1.
What is the InChIKey of 2-(4,6-dimethoxypyrimidin-2-yl)oxy-6-phenylbenzenecarbothioic S-acid?
The InChIKey is BFFRRIQZQIISDK-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H16N2O4S/c1-23-15-11-16(24-2)21-19(20-15)25-14-10-6-9-13(17(14)18(22)26)12-7-4-3-5-8-12/h3-11H,1-2H3,(H,22,26).
What are the key properties of 2-(4,6-dimethoxypyrimidin-2-yl)oxy-6-phenylbenzenecarbothioic S-acid?
2-(4,6-dimethoxypyrimidin-2-yl)oxy-6-phenylbenzenecarbothioic S-acid has a molecular weight of 368.41 g/mol, XLogP of 4.02, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4,6-dimethoxypyrimidin-2-yl)oxy-6-phenylbenzenecarbothioic S-acid is sourced from PubChem (CID 19901305), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).