C19H16N2O4S — CID 19901305
2-(4,6-dimethoxypyrimidin-2-yl)oxy-6-phenylbenzenecarbothioic S-acid (PubChem CID 19901305) has the molecular formula C19H16N2O4S and a molecular weight of 368.41 g/mol. Its IUPAC name is 2-(4,6-dimethoxypyrimidin-2-yl)oxy-6-phenylbenzenecarbothioic S-acid.
| Compound Name | 2-(4,6-dimethoxypyrimidin-2-yl)oxy-6-phenylbenzenecarbothioic S-acid |
|---|---|
| PubChem CID | 19901305 |
| Molecular Formula | C19H16N2O4S |
| Molecular Weight | 368.41 g/mol |
| Exact Mass | 368.08 |
| IUPAC Name | 2-(4,6-dimethoxypyrimidin-2-yl)oxy-6-phenylbenzenecarbothioic S-acid |
| SMILES | COc1cc(OC)nc(Oc2cccc(-c3ccccc3)c2C(=O)S)n1 |
| InChI | InChI=1S/C19H16N2O4S/c1-23-15-11-16(24-2)21-19(20-15)25-14-10-6-9-13(17(14)18(22)26)12-7-4-3-5-8-12/h3-11H,1-2H3,(H,22,26) |
| InChIKey | BFFRRIQZQIISDK-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 70.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.41 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|