C20H15N3O5 — CID 134110522
2-(5-cyano-4,6-dimethoxypyrimidin-2-yl)oxy-6-phenylbenzoic acid (PubChem CID 134110522) has the molecular formula C20H15N3O5 and a molecular weight of 377.36 g/mol. Its IUPAC name is 2-(5-cyano-4,6-dimethoxypyrimidin-2-yl)oxy-6-phenylbenzoic acid.
| Compound Name | 2-(5-cyano-4,6-dimethoxypyrimidin-2-yl)oxy-6-phenylbenzoic acid |
|---|---|
| PubChem CID | 134110522 |
| Molecular Formula | C20H15N3O5 |
| Molecular Weight | 377.36 g/mol |
| Exact Mass | 377.10 |
| IUPAC Name | 2-(5-cyano-4,6-dimethoxypyrimidin-2-yl)oxy-6-phenylbenzoic acid |
| SMILES | COc1nc(Oc2cccc(-c3ccccc3)c2C(=O)O)nc(OC)c1C#N |
| InChI | InChI=1S/C20H15N3O5/c1-26-17-14(11-21)18(27-2)23-20(22-17)28-15-10-6-9-13(16(15)19(24)25)12-7-4-3-5-8-12/h3-10H,1-2H3,(H,24,25) |
| InChIKey | RVSQMUDXXITVGY-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 114.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.36 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |