C19H16N2O5 — CID 14880647
2-(4,6-dimethoxypyrimidin-2-yl)oxy-6-phenylbenzoic acid (PubChem CID 14880647) has the molecular formula C19H16N2O5 and a molecular weight of 352.35 g/mol. Its IUPAC name is 2-(4,6-dimethoxypyrimidin-2-yl)oxy-6-phenylbenzoic acid.
| Compound Name | 2-(4,6-dimethoxypyrimidin-2-yl)oxy-6-phenylbenzoic acid |
|---|---|
| PubChem CID | 14880647 |
| Molecular Formula | C19H16N2O5 |
| Molecular Weight | 352.35 g/mol |
| Exact Mass | 352.11 |
| IUPAC Name | 2-(4,6-dimethoxypyrimidin-2-yl)oxy-6-phenylbenzoic acid |
| SMILES | COc1cc(OC)nc(Oc2cccc(-c3ccccc3)c2C(=O)O)n1 |
| InChI | InChI=1S/C19H16N2O5/c1-24-15-11-16(25-2)21-19(20-15)26-14-10-6-9-13(17(14)18(22)23)12-7-4-3-5-8-12/h3-11H,1-2H3,(H,22,23) |
| InChIKey | WXUAITUHDSCEPQ-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 90.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.35 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |