C18H21N3O4 — CID 20850303
N-cyclopentyl-2-(4,6-dimethoxypyrimidin-2-yl)oxybenzamide (PubChem CID 20850303) has the molecular formula C18H21N3O4 and a molecular weight of 343.38 g/mol. Its IUPAC name is N-cyclopentyl-2-(4,6-dimethoxypyrimidin-2-yl)oxybenzamide.
| Compound Name | N-cyclopentyl-2-(4,6-dimethoxypyrimidin-2-yl)oxybenzamide |
|---|---|
| PubChem CID | 20850303 |
| Molecular Formula | C18H21N3O4 |
| Molecular Weight | 343.38 g/mol |
| Exact Mass | 343.15 |
| IUPAC Name | N-cyclopentyl-2-(4,6-dimethoxypyrimidin-2-yl)oxybenzamide |
| SMILES | COc1cc(OC)nc(Oc2ccccc2C(=O)NC2CCCC2)n1 |
| InChI | InChI=1S/C18H21N3O4/c1-23-15-11-16(24-2)21-18(20-15)25-14-10-6-5-9-13(14)17(22)19-12-7-3-4-8-12/h5-6,9-12H,3-4,7-8H2,1-2H3,(H,19,22) |
| InChIKey | JCNASRKZVXRAAC-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 82.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.38 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |