C19H21N3O6 — CID 20788800
methyl (2S)-2-[[2-(4,6-dimethoxypyrimidin-2-yl)oxybenzoyl]amino]pent-4-enoate (PubChem CID 20788800) has the molecular formula C19H21N3O6 and a molecular weight of 387.39 g/mol. Its IUPAC name is methyl (2S)-2-[[2-(4,6-dimethoxypyrimidin-2-yl)oxybenzoyl]amino]pent-4-enoate.
| Compound Name | methyl (2S)-2-[[2-(4,6-dimethoxypyrimidin-2-yl)oxybenzoyl]amino]pent-4-enoate |
|---|---|
| PubChem CID | 20788800 |
| Molecular Formula | C19H21N3O6 |
| Molecular Weight | 387.39 g/mol |
| Exact Mass | 387.14 |
| IUPAC Name | methyl (2S)-2-[[2-(4,6-dimethoxypyrimidin-2-yl)oxybenzoyl]amino]pent-4-enoate |
| SMILES | C=CC[C@H](NC(=O)c1ccccc1Oc1nc(OC)cc(OC)n1)C(=O)OC |
| InChI | InChI=1S/C19H21N3O6/c1-5-8-13(18(24)27-4)20-17(23)12-9-6-7-10-14(12)28-19-21-15(25-2)11-16(22-19)26-3/h5-7,9-11,13H,1,8H2,2-4H3,(H,20,23)/t13-/m0/s1 |
| InChIKey | KPMLVVJSHQJHKH-ZDUSSCGKSA-N |
| XLogP | 2.13 |
| TPSA | 108.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.39 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|