About prop-2-enyl (2S)-2-[[2-(4,6-dimethoxypyrimidin-2-yl)oxybenzoyl]amino]-3-methylpentanoate
prop-2-enyl (2S)-2-[[2-(4,6-dimethoxypyrimidin-2-yl)oxybenzoyl]amino]-3-methylpentanoate (PubChem CID 20788816) has the molecular formula C22H27N3O6
and a molecular weight of 429.47 g/mol. Its IUPAC name is prop-2-enyl (2S)-2-[[2-(4,6-dimethoxypyrimidin-2-yl)oxybenzoyl]amino]-3-methylpentanoate.
Molecular Properties
| Compound Name | prop-2-enyl (2S)-2-[[2-(4,6-dimethoxypyrimidin-2-yl)oxybenzoyl]amino]-3-methylpentanoate |
| PubChem CID | 20788816 |
| Molecular Formula | C22H27N3O6 |
| Molecular Weight | 429.47 g/mol |
| Exact Mass | 429.19 |
| IUPAC Name | prop-2-enyl (2S)-2-[[2-(4,6-dimethoxypyrimidin-2-yl)oxybenzoyl]amino]-3-methylpentanoate |
| SMILES | C=CCOC(=O)[C@@H](NC(=O)c1ccccc1Oc1nc(OC)cc(OC)n1)C(C)CC |
| InChI | InChI=1S/C22H27N3O6/c1-6-12-30-21(27)19(14(3)7-2)25-20(26)15-10-8-9-11-16(15)31-22-23-17(28-4)13-18(24-22)29-5/h6,8-11,13-14,19H,1,7,12H2,2-5H3,(H,25,26)/t14?,19-/m0/s1 |
| InChIKey | NWMCBEAFWZEXKH-PKDNWHCCSA-N |
| XLogP | 3.16 |
| TPSA | 108.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 429.47 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze prop-2-enyl (2S)-2-[[2-(4,6-dimethoxypyrimidin-2-yl)oxybenzoyl]amino]-3-methylpentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of prop-2-enyl (2S)-2-[[2-(4,6-dimethoxypyrimidin-2-yl)oxybenzoyl]amino]-3-methylpentanoate?
The IUPAC name of prop-2-enyl (2S)-2-[[2-(4,6-dimethoxypyrimidin-2-yl)oxybenzoyl]amino]-3-methylpentanoate (CID 20788816) is prop-2-enyl (2S)-2-[[2-(4,6-dimethoxypyrimidin-2-yl)oxybenzoyl]amino]-3-methylpentanoate.
What is the SMILES notation for prop-2-enyl (2S)-2-[[2-(4,6-dimethoxypyrimidin-2-yl)oxybenzoyl]amino]-3-methylpentanoate?
The canonical SMILES for prop-2-enyl (2S)-2-[[2-(4,6-dimethoxypyrimidin-2-yl)oxybenzoyl]amino]-3-methylpentanoate is C=CCOC(=O)[C@@H](NC(=O)c1ccccc1Oc1nc(OC)cc(OC)n1)C(C)CC.
What is the InChIKey of prop-2-enyl (2S)-2-[[2-(4,6-dimethoxypyrimidin-2-yl)oxybenzoyl]amino]-3-methylpentanoate?
The InChIKey is NWMCBEAFWZEXKH-PKDNWHCCSA-N. The full InChI is InChI=1S/C22H27N3O6/c1-6-12-30-21(27)19(14(3)7-2)25-20(26)15-10-8-9-11-16(15)31-22-23-17(28-4)13-18(24-22)29-5/h6,8-11,13-14,19H,1,7,12H2,2-5H3,(H,25,26)/t14?,19-/m0/s1.
What are the key properties of prop-2-enyl (2S)-2-[[2-(4,6-dimethoxypyrimidin-2-yl)oxybenzoyl]amino]-3-methylpentanoate?
prop-2-enyl (2S)-2-[[2-(4,6-dimethoxypyrimidin-2-yl)oxybenzoyl]amino]-3-methylpentanoate has a molecular weight of 429.47 g/mol, XLogP of 3.16, 11 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for prop-2-enyl (2S)-2-[[2-(4,6-dimethoxypyrimidin-2-yl)oxybenzoyl]amino]-3-methylpentanoate is sourced from PubChem (CID 20788816), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).